ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7623-11-2 2-Chlorobutyryl chloride |
|
| 상품명칭 | 2-Chlorobutyryl chloride |
| 영문 이름 | 2-Chlorobutyryl chloride;2-Chlorobutyryl chloride;2-chlorobutanoyl chloride |
| 분자식 | C4H6Cl2O |
| 분자량 | 140.9958 |
| InChI | InChI=1/C4H6Cl2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 |
| cas번호 | 7623-11-2 |
| 분자 구조 | ![]() |
| 밀도 | 1.227g/cm3 |
| 비등점 | 130.5°C at 760 mmHg |
| 굴절 지수 | 1.44 |
| 인화점 | 53.2°C |
| 증기압 | 9.68mmHg at 25°C |
| 리스크 규칙 | R34##Causes burns.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |