ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
914389-28-9 methyl (4R)-6-[2-(methylamino)-2-oxo-ethyl]-5-oxo-1,6-diazaspiro[3.3]heptane-1-carboxylate |
|
| 상품명칭 | methyl (4R)-6-[2-(methylamino)-2-oxo-ethyl]-5-oxo-1,6-diazaspiro[3.3]heptane-1-carboxylate |
| 영문 이름 | methyl (4R)-6-[2-(methylamino)-2-oxo-ethyl]-5-oxo-1,6-diazaspiro[3.3]heptane-1-carboxylate; |
| 분자식 | C10H15N3O4 |
| 분자량 | 241.24 |
| InChI | InChI=1/C10H15N3O4/c1-11-7(14)5-12-6-10(8(12)15)3-4-13(10)9(16)17-2/h3-6H2,1-2H3,(H,11,14)/t10-/m1/s1 |
| cas번호 | 914389-28-9 |
| 분자 구조 | ![]() |
| 밀도 | 1.37g/cm3 |
| 비등점 | 522.6°C at 760 mmHg |
| 굴절 지수 | 1.573 |
| 인화점 | 269.9°C |
| 증기압 | 5.11E-11mmHg at 25°C |
| MSDS | |