ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
91634-08-1 3,5-diiodo-4-(prop-2-en-1-yloxy)benzoic 산 |
|
| 상품명칭 | 3,5-diiodo-4-(prop-2-en-1-yloxy)benzoic 산 |
| 별명 | ; |
| 영문 이름 | 3,5-diiodo-4-(prop-2-en-1-yloxy)benzoic acid; |
| 분자식 | C10H8I2O3 |
| 분자량 | 429.9777 |
| InChI | InChI=1/C10H8I2O3/c1-2-3-15-9-7(11)4-6(10(13)14)5-8(9)12/h2,4-5H,1,3H2,(H,13,14) |
| cas번호 | 91634-08-1 |
| 분자 구조 | ![]() |
| 밀도 | 2.169g/cm3 |
| 비등점 | 467.8°C at 760 mmHg |
| 굴절 지수 | 1.677 |
| 인화점 | 236.7°C |
| 증기압 | 1.49E-09mmHg at 25°C |
| MSDS | |