ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
93739-18-5 S~1~,S~2~-bis[2-(acetylamino)ethyl] ethanebis(thioate) |
|
| 상품명칭 | S~1~,S~2~-bis[2-(acetylamino)ethyl] ethanebis(thioate) |
| 영문 이름 | S~1~,S~2~-bis[2-(acetylamino)ethyl] ethanebis(thioate); |
| 분자식 | C10H16N2O4S2 |
| 분자량 | 292.375 |
| InChI | InChI=1/C10H16N2O4S2/c1-7(13)11-3-5-17-9(15)10(16)18-6-4-12-8(2)14/h3-6H2,1-2H3,(H,11,13)(H,12,14) |
| cas번호 | 93739-18-5 |
| 분자 구조 | ![]() |
| 밀도 | 1.284g/cm3 |
| 비등점 | 570.2°C at 760 mmHg |
| 굴절 지수 | 1.542 |
| 인화점 | 298.6°C |
| 증기압 | 5.18E-13mmHg at 25°C |
| MSDS | |