ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97606-39-8 1- [4- (디메틸 아미노) 페닐] -2- 페닐 -1- 에타논 |
|
상품명칭 | 1- [4- (디메틸 아미노) 페닐] -2- 페닐 -1- 에타논 |
별명 | 1- [4- (디메틸 아미노) 페닐] -2- 페닐 에탄온; |
영문 이름 | 1-[4-(dimethylamino)phenyl]-2-phenyl-1-ethanone;1-[4-(dimethylamino)phenyl]-2-phenylethanone |
분자식 | C16H17NO |
분자량 | 239.3123 |
InChI | InChI=1/C16H17NO/c1-17(2)15-10-8-14(9-11-15)16(18)12-13-6-4-3-5-7-13/h3-11H,12H2,1-2H3 |
cas번호 | 97606-39-8 |
분자 구조 | ![]() |
밀도 | 1.089g/cm3 |
녹는 점 | 164℃ |
비등점 | 401.2°C at 760 mmHg |
굴절 지수 | 1.599 |
인화점 | 155.8°C |
증기압 | 1.21E-06mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |