ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98510-87-3 디 이소 부틸 인산 수소, 2- 에틸 -N- (2- 에틸 헥실) 헥실 아민 (1 : 1)과 화합물 |
|
상품명칭 | 디 이소 부틸 인산 수소, 2- 에틸 -N- (2- 에틸 헥실) 헥실 아민 (1 : 1)과 화합물 |
별명 | Diisobutyl 수소 인산염, 2-에틸-N-(2-에틸헥실)헥실아민(1:1)과 화합물; 디이소부틸 인산수소; 2-에틸-N-(2-에틸헥실)헥산-1-아민; |
영문 이름 | diisobutyl hydrogen phosphate, compound with 2-ethyl-N-(2-ethylhexyl)hexylamine (1:1);Diisobutyl hydrogen phosphate, compound with 2-ethyl-N-(2-ethylhexyl)hexylamine (1:1);diisobutyl hydrogen phosphate; 2-ethyl-N-(2-ethylhexyl)hexan-1-amine |
분자식 | C24H54NO4P |
분자량 | 451.6636 |
InChI | InChI=1/C16H35N.C8H19O4P/c1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2;1-7(2)5-11-13(9,10)12-6-8(3)4/h15-17H,5-14H2,1-4H3;7-8H,5-6H2,1-4H3,(H,9,10) |
cas번호 | 98510-87-3 |
EC번호 | 308-795-9 |
분자 구조 | ![]() |
비등점 | 508.1°C at 760 mmHg |
인화점 | 261.1°C |
증기압 | 1.07E-11mmHg at 25°C |
MSDS |