ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101-99-5 N-Phenylurethane |
|
| Nama produk | N-Phenylurethane |
| Nama Inggeris | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
| MF | C9H11NO2 |
| Berat Molekul | 165.1891 |
| InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| CAS NO | 101-99-5 |
| EINECS | 202-995-9 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.136g/cm3 |
| Titik didih | 238°C at 760 mmHg |
| Indeks bias | 1.558 |
| Titik nyala | 79.2°C |
| Tekanan wap | 0.0434mmHg at 25°C |
| Kod Risiko | R40##Possible risks of irreversible effects.:; |
| Keselamatan Penerangan | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |