ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
10401-11-3 3-Hydroxyphenylacetylene |
|
| Nama produk | 3-Hydroxyphenylacetylene |
| Nama Inggeris | 3-Hydroxyphenylacetylene;3-Ethynylphenol |
| MF | C8H6O |
| Berat Molekul | 118.1326 |
| InChI | InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
| CAS NO | 10401-11-3 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.12g/cm3 |
| Titik didih | 230.9°C at 760 mmHg |
| Indeks bias | 1.589 |
| Titik nyala | 106.1°C |
| Tekanan wap | 0.0424mmHg at 25°C |
| Kod Risiko | R36/38##Irritating to eyes and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |