ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
16018-83-0 1-(4-Fluorophenyl)biguanidine hydrochloride |
|
Nama produk | 1-(4-Fluorophenyl)biguanidine hydrochloride |
Nama Inggeris | 1-(4-Fluorophenyl)biguanidine hydrochloride;1-(4-Fluorophenyl)biguanide hydrochloride |
MF | C8H10FN5 |
Berat Molekul | 195.19 |
InChI | InChI=1/C8H10FN5.ClH/c9-5-1-3-6(4-2-5)13-8(12)14-7(10)11;/h1-4H,(H6,10,11,12,13,14);1H |
CAS NO | 16018-83-0 |
Struktur Molekul | ![]() |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |