Chemindex >17969-22-1
MY ▼
17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
|
| Nama produk | 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
| Nama Inggeris | 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole; |
| MF | C10H7Cl2NS |
| Berat Molekul | 244.1403 |
| InChI | InChI=1/C10H7Cl2NS/c11-5-9-6-14-10(13-9)7-1-3-8(12)4-2-7/h1-4,6H,5H2 |
| CAS NO | 17969-22-1 |
| Struktur Molekul |  |
| Kepadatan | 1.378g/cm3 |
| Titik lebur | 78℃ |
| Titik didih | 374°C at 760 mmHg |
| Indeks bias | 1.617 |
| Titik nyala | 180°C |
| Tekanan wap | 1.85E-05mmHg at 25°C |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 