ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
20475-12-1 tris(2-hydroxyethyl)ammonium laktat |
|
Nama produk | tris(2-hydroxyethyl)ammonium laktat |
Sinonim | Asid laktik, compd.with 2,2',2'-nitrilotri(etanol) (1:1); TEH-Laktate; Triethanolamine laktat; Asid propanoic, 2-hydroxy-, compd.dengan 2,2',2'-Nitrilotris(etanol) (1:1); Tris(2-hydroxyethyl)ammonium laktat; Asid 2-hydroxypropanoic - 2,2',2'-nitrilotriethanol (1:1); |
Nama Inggeris | tris(2-hydroxyethyl)ammonium lactate;Lactic acid, compd. with 2,2',2''-nitrilotri(ethanol) (1:1);TEA-Lactate;Triethanolamine lactate;Propanoic acid, 2-hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);Tris(2-hydroxyethyl)ammonium lactate;2-hydroxypropanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
MF | C9H21NO6 |
Berat Molekul | 239.2661 |
InChI | InChI=1/C6H15NO3.C3H6O3/c8-4-1-7(2-5-9)3-6-10;1-2(4)3(5)6/h8-10H,1-6H2;2,4H,1H3,(H,5,6) |
CAS NO | 20475-12-1 |
EINECS | 243-846-8 |
Struktur Molekul | ![]() |
Titik didih | 335.4°C at 760 mmHg |
Titik nyala | 185°C |
Tekanan wap | 8.38E-06mmHg at 25°C |
MSDS |