ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
260-94-6 Acridine |
|
| Nama produk | Acridine |
| Nama Inggeris | Acridine;Dibenzo[b,e]pyridine |
| MF | C13H9N |
| Berat Molekul | 179.2173 |
| InChI | InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
| CAS NO | 260-94-6 |
| EINECS | 205-971-6 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.187g/cm3 |
| Titik lebur | 105-110℃ |
| Titik didih | 346.7°C at 760 mmHg |
| Indeks bias | 1.726 |
| Titik nyala | 153.8°C |
| Tekanan wap | 0.000113mmHg at 25°C |
| Cinta bahaya | |
| Kod Risiko | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |