ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27151-57-1 4,4'-Dimethoxy-N-methyldiphenylamine |
|
Nama produk | 4,4'-Dimethoxy-N-methyldiphenylamine |
Nama Inggeris | 4,4'-Dimethoxy-N-methyldiphenylamine;N-(4-Methoxyphenyl)-N-methyl-p-anisidine;4-methoxy-N-(4-methoxyphenyl)-N-methylaniline |
MF | C15H17NO2 |
Berat Molekul | 243.301 |
InChI | InChI=1/C15H17NO2/c1-16(12-4-8-14(17-2)9-5-12)13-6-10-15(18-3)11-7-13/h4-11H,1-3H3 |
CAS NO | 27151-57-1 |
EINECS | 248-265-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.095g/cm3 |
Titik didih | 387.3°C at 760 mmHg |
Indeks bias | 1.578 |
Titik nyala | 145.9°C |
Tekanan wap | 3.32E-06mmHg at 25°C |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Penerangan | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |