ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
352018-91-8 1-(4-cyanophenyl)-4-piperidinecarbohydrazide |
|
Nama produk | 1-(4-cyanophenyl)-4-piperidinecarbohydrazide |
Sinonim | 1-(4-cyanophenyl)piperidine-4-carbohydrazide; |
Nama Inggeris | 1-(4-cyanophenyl)-4-piperidinecarbohydrazide;1-(4-cyanophenyl)piperidine-4-carbohydrazide |
MF | C13H16N4O |
Berat Molekul | 244.2923 |
InChI | InChI=1/C13H16N4O/c14-9-10-1-3-12(4-2-10)17-7-5-11(6-8-17)13(18)16-15/h1-4,11H,5-8,15H2,(H,16,18) |
CAS NO | 352018-91-8 |
Struktur Molekul | ![]() |
Kepadatan | 1.251g/cm3 |
Titik didih | 528.975°C at 760 mmHg |
Indeks bias | 1.617 |
Titik nyala | 273.715°C |
Tekanan wap | 0mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Penerangan | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |