ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
35281-27-7 3-methyl-1,2,6,7,8,9,10,12b-octahydrocyclopenta[ij]tetraphene |
|
| Nama produk | 3-methyl-1,2,6,7,8,9,10,12b-octahydrocyclopenta[ij]tetraphene |
| Sinonim | ; |
| Nama Inggeris | 3-methyl-1,2,6,7,8,9,10,12b-octahydrocyclopenta[ij]tetraphene; |
| MF | C21H22 |
| Berat Molekul | 274.3994 |
| InChI | InChI=1/C21H22/c1-13-6-7-15-12-20-17-5-3-2-4-14(17)8-9-18(20)19-11-10-16(13)21(15)19/h6-9,19H,2-5,10-12H2,1H3 |
| CAS NO | 35281-27-7 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.128g/cm3 |
| Titik didih | 417.4°C at 760 mmHg |
| Indeks bias | 1.638 |
| Titik nyala | 228.9°C |
| Tekanan wap | 8.62E-07mmHg at 25°C |
| MSDS | |