ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-99-2 etil 4-(hydroxymethyl)-1,3,5-trimethyl-1H-pyrrole-2-carboxylate |
|
Nama produk | etil 4-(hydroxymethyl)-1,3,5-trimethyl-1H-pyrrole-2-carboxylate |
Sinonim | etil 4-(hydroxymethyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate; |
Nama Inggeris | ethyl 4-(hydroxymethyl)-1,3,5-trimethyl-1H-pyrrole-2-carboxylate;ethyl 4-(hydroxymethyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
MF | C10H15NO3 |
Berat Molekul | 197.231 |
InChI | InChI=1/C10H15NO3/c1-4-14-10(13)9-6(2)8(5-12)7(3)11-9/h11-12H,4-5H2,1-3H3 |
CAS NO | 368869-99-2 |
Struktur Molekul | ![]() |
Kepadatan | 1.17g/cm3 |
Titik lebur | 231℃ |
Titik didih | 360.6°C at 760 mmHg |
Indeks bias | 1.543 |
Titik nyala | 171.9°C |
Tekanan wap | 7.89E-06mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |