ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
370-81-0 Oxalic acid bis(cyclohexylidenehydrazide) |
|
| Nama produk | Oxalic acid bis(cyclohexylidenehydrazide) |
| Nama Inggeris | Oxalic acid bis(cyclohexylidenehydrazide);Cuprizon 1;Bis(cyclohexanone)oxaldihydrazone;oxalic bis(cyclohexylidenehydrazide);N,N-oxalylbis(cyclohexanone hydrazone);Cuprizon l;cuprizon;Oxalic acid bis (cyclohexylidenehydrazide);N'~1~,N'~2~-dicyclohexylideneethanedihydrazide |
| MF | C14H22N4O2 |
| Berat Molekul | 278.3501 |
| InChI | InChI=1/C14H22N4O2/c19-13(17-15-11-7-3-1-4-8-11)14(20)18-16-12-9-5-2-6-10-12/h1-10H2,(H,17,19)(H,18,20) |
| CAS NO | 370-81-0 |
| EINECS | 206-729-2 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.29g/cm3 |
| Titik lebur | 208-214℃ |
| Indeks bias | 1.625 |
| Cinta bahaya | |
| Kod Risiko | R21/22##Harmful in contact with skin and if swallowed.:; |
| Keselamatan Penerangan | S2##Keep out of reach of children||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |