Chemindex >42601-04-7
MY ▼
42601-04-7 3,4-Difluorophenyl isocyanate |
|
| Nama produk | 3,4-Difluorophenyl isocyanate |
| Nama Inggeris | 3,4-Difluorophenyl isocyanate;1,2-difluoro-4-isocyanatobenzene |
| MF | C7H3F2NO |
| Berat Molekul | 155.1016 |
| InChI | InChI=1/C7H3F2NO/c8-6-2-1-5(10-4-11)3-7(6)9/h1-3H |
| CAS NO | 42601-04-7 |
| Struktur Molekul |  |
| Kepadatan | 1.24g/cm3 |
| Titik didih | 186.4°C at 760 mmHg |
| Indeks bias | 1.488 |
| Titik nyala | 58.9°C |
| Tekanan wap | 0.665mmHg at 25°C |
| Cinta bahaya |  Xn##Harmful:; |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 42601-04-7 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 