ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
43111-31-5 2-Chlorophenoxyacetonitrile |
|
| Nama produk | 2-Chlorophenoxyacetonitrile |
| Nama Inggeris | 2-Chlorophenoxyacetonitrile; |
| MF | C8H6ClNO |
| Berat Molekul | 167.5923 |
| InChI | InChI=1/C8H6ClNO/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4H,6H2 |
| CAS NO | 43111-31-5 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.238g/cm3 |
| Titik didih | 276.7°C at 760 mmHg |
| Indeks bias | 1.538 |
| Titik nyala | 121.2°C |
| Tekanan wap | 0.00472mmHg at 25°C |
| Cinta bahaya | |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Keselamatan Penerangan | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |