ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
459-05-2 1-(4-fluorophenyl)-2-thiourea |
|
| Nama produk | 1-(4-fluorophenyl)-2-thiourea |
| Nama Inggeris | 1-(4-fluorophenyl)-2-thiourea;4-Fluorophenylthiourea;1-(4-fluorophenyl)thiourea |
| MF | C7H7FN2S |
| Berat Molekul | 170.2073 |
| InChI | InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| CAS NO | 459-05-2 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.397g/cm3 |
| Titik lebur | 164℃ |
| Titik didih | 264.2°C at 760 mmHg |
| Indeks bias | 1.692 |
| Titik nyala | 113.6°C |
| Tekanan wap | 0.00987mmHg at 25°C |
| Kod Risiko | R25##Toxic if swallowed.:; |
| Keselamatan Penerangan | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |