Chemindex >56107-02-9
MY ▼
56107-02-9 4-Chloro-3-nitrobenzophenone |
|
| Nama produk | 4-Chloro-3-nitrobenzophenone |
| Nama Inggeris | 4-Chloro-3-nitrobenzophenone;(4-Chloro-3-nitrophenyl)phenylmethanone |
| MF | C13H8ClNO3 |
| Berat Molekul | 261.6605 |
| InChI | InChI=1/C13H8ClNO3/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9/h1-8H |
| CAS NO | 56107-02-9 |
| EINECS | 259-995-7 |
| Struktur Molekul |  |
| Kepadatan | 1.367g/cm3 |
| Titik lebur | 101-107℃ |
| Titik didih | 386.5°C at 760 mmHg |
| Indeks bias | 1.623 |
| Titik nyala | 203.4°C |
| Tekanan wap | 3.53E-06mmHg at 25°C |
| Cinta bahaya |  Xn##Harmful:; |
| Kod Risiko | R20/21##Harmful by inhalation and in contact with skin.:; |
| Keselamatan Penerangan | S22##Do not inhale dust.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 