Chemindex >62524-21-4
MY ▼
62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide |
|
| Nama produk | 3-chlorobenzo[b]thiophene-2-carbohydrazide |
| Nama Inggeris | 3-chlorobenzo[b]thiophene-2-carbohydrazide;3-chloro-1-benzothiophene-2-carbohydrazide;3-Chlorobenzothiophene-2-carboxylic acid hydrazide |
| MF | C9H7ClN2OS |
| Berat Molekul | 226.6827 |
| InChI | InChI=1/C9H7ClN2OS/c10-7-5-3-1-2-4-6(5)14-8(7)9(13)12-11/h1-4H,11H2,(H,12,13) |
| CAS NO | 62524-21-4 |
| Struktur Molekul | ![62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide](https://images-a.chemnet.com/suppliers/chembase/132/13230.gif "62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide") |
| Kepadatan | 1.486g/cm3 |
| Titik lebur | 181℃ |
| Indeks bias | 1.714 |
| Cinta bahaya |  Xi##Irritant:; |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 62524-21-4 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 