ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6282-00-4 NN-Dipropylformamide |
|
Nama produk | NN-Dipropylformamide |
Nama Inggeris | NN-Dipropylformamide;N,N-Di-n-propylformamide;N,N-dipropylformamide |
MF | C7H15NO |
Berat Molekul | 129.2001 |
InChI | InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
CAS NO | 6282-00-4 |
Struktur Molekul | ![]() |
Kepadatan | 0.869g/cm3 |
Titik didih | 221.3°C at 760 mmHg |
Indeks bias | 1.429 |
Titik nyala | 83.7°C |
Tekanan wap | 0.108mmHg at 25°C |
Kod Risiko | R36/38##Irritating to eyes and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |