ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70299-57-9 1-(2-{[(Z)-1,3-benzothiazol-2(3H)-ylidenemethyl]amino}-2-oxoethyl)piperidinium chloride |
|
| Nama produk | 1-(2-{[(Z)-1,3-benzothiazol-2(3H)-ylidenemethyl]amino}-2-oxoethyl)piperidinium chloride |
| Sinonim | ; |
| Nama Inggeris | 1-(2-{[(Z)-1,3-benzothiazol-2(3H)-ylidenemethyl]amino}-2-oxoethyl)piperidinium chloride; |
| MF | C15H20ClN3OS |
| Berat Molekul | 325.8568 |
| InChI | InChI=1/C15H19N3OS.ClH/c19-14(11-18-8-4-1-5-9-18)16-10-15-17-12-6-2-3-7-13(12)20-15;/h2-3,6-7,10,17H,1,4-5,8-9,11H2,(H,16,19);1H/b15-10-; |
| CAS NO | 70299-57-9 |
| Struktur Molekul | ![]() |
| Titik didih | 468°C at 760 mmHg |
| Titik nyala | 236.8°C |
| Tekanan wap | 6.22E-09mmHg at 25°C |
| MSDS | |