ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71929-21-0 Asid 10-hydroxyoctadecanoic, monoester dengan gliserol |
|
| Nama produk | Asid 10-hydroxyoctadecanoic, monoester dengan gliserol |
| Sinonim | 10-Hydroxyoctadecanoic asid, monoester dengan gliserol |
| Nama Inggeris | 10-hydroxyoctadecanoic acid, monoester with glycerol;10-Hydroxyoctadecanoic acid, monoester with glycerol |
| MF | C21H42O5 |
| Berat Molekul | 374.5578 |
| InChI | InChI=1/C21H42O5/c1-2-3-4-5-8-11-14-19(24)15-12-9-6-7-10-13-16-21(25)26-20(17-22)18-23/h19-20,22-24H,2-18H2,1H3 |
| CAS NO | 71929-21-0 |
| EINECS | 276-193-2 |
| Struktur Molekul | ![]() |
| MSDS | |