ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72-54-8 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
|
| Nama produk | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
| Nama Inggeris | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane; |
| MF | C14H10Cl4 |
| Berat Molekul | 320.04 |
| InChI | InChI=1/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
| CAS NO | 72-54-8 |
| EINECS | 200-783-0 |
| Struktur Molekul | ![]() |
| Titik lebur | 109-111℃ |
| Cinta bahaya | |
| Kod Risiko | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| Keselamatan Penerangan | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |