ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
855-96-9 3',5-Dihydroxy-4',6,7-trimethoxyflavone |
|
Nama produk | 3',5-Dihydroxy-4',6,7-trimethoxyflavone |
Nama Inggeris | 3',5-Dihydroxy-4',6,7-trimethoxyflavone;Eupatorin;5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-6,7-dimethoxy-4H-chromen-4-one |
MF | C18H16O7 |
Berat Molekul | 344.3154 |
InChI | InChI=1/C18H16O7/c1-22-12-5-4-9(6-10(12)19)13-7-11(20)16-14(25-13)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3 |
CAS NO | 855-96-9 |
Struktur Molekul | ![]() |
Kepadatan | 1.387g/cm3 |
Titik didih | 587°C at 760 mmHg |
Indeks bias | 1.627 |
Titik nyala | 216°C |
Tekanan wap | 2.24E-14mmHg at 25°C |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |