ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98-81-7 alpha-bromostyrene | 
    |
| Nama produk | alpha-bromostyrene | 
| Nama Inggeris | alpha-bromostyrene;1-(1-Bromovinyl)benzene;(1-bromoethenyl)benzene | 
| MF | C8H7Br | 
| Berat Molekul | 183.0452 | 
| InChI | InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 | 
| CAS NO | 98-81-7 | 
| EINECS | 202-702-4 | 
| Struktur Molekul | ![]()  | 
    
| Kepadatan | 1.387g/cm3 | 
| Titik lebur | -44℃ | 
| Titik didih | 212.6°C at 760 mmHg | 
| Indeks bias | 1.574 | 
| Titik nyala | 98.3°C | 
| Tekanan wap | 0.249mmHg at 25°C | 
| Cinta bahaya | |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; | 
    
| MSDS | |