ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101-99-5 N-Phenylurethane |
|
| Naam product | N-Phenylurethane |
| Engelse naam | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
| MF | C9H11NO2 |
| Molecuulgewicht | 165.1891 |
| InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| CAS-nummer | 101-99-5 |
| EINECS | 202-995-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.136g/cm3 |
| Kookpunt | 238°C at 760 mmHg |
| Brekingsindex | 1.558 |
| Vlampunt | 79.2°C |
| Dampdruk | 0.0434mmHg at 25°C |
| Risico-codes | R40##Possible risks of irreversible effects.:; |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |