ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
10203-32-4 4-Dodecanol |
|
Naam product | 4-Dodecanol |
Engelse naam | 4-Dodecanol;n-Octyl-n-propyl carbinol;dodecan-4-ol |
MF | C12H26O |
Molecuulgewicht | 186.3342 |
InChI | InChI=1/C12H26O/c1-3-5-6-7-8-9-11-12(13)10-4-2/h12-13H,3-11H2,1-2H3 |
CAS-nummer | 10203-32-4 |
EINECS | 233-502-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 0.829g/cm3 |
Kookpunt | 245.5°C at 760 mmHg |
Brekingsindex | 1.439 |
Vlampunt | 100.1°C |
Dampdruk | 0.00476mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |