Chemindex > 10401-11-3
NL â–¼
10401-11-3 3-Hydroxyphenylacetylene |
|
| Naam product | 3-Hydroxyphenylacetylene |
| Engelse naam | 3-Hydroxyphenylacetylene;3-Ethynylphenol |
| MF | C8H6O |
| Molecuulgewicht | 118.1326 |
| InChI | InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
| CAS-nummer | 10401-11-3 |
| Moleculaire Structuur |  |
| Dichtheid | 1.12g/cm3 |
| Kookpunt | 230.9°C at 760 mmHg |
| Brekingsindex | 1.589 |
| Vlampunt | 106.1°C |
| Dampdruk | 0.0424mmHg at 25°C |
| Risico-codes | R36/38##Irritating to eyes and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 10401-11-3 (0):
Chemical CAS Database Service wordt geleverd door ChemIndex.com 