Chemindex > 110-49-6
NL ▼
110-49-6 2-Methoxyethyl acetate |
|
| Naam product | 2-Methoxyethyl acetate |
| Engelse naam | 2-Methoxyethyl acetate;Methyl Cellosolve?acetate;1-Acetoxy-2-methoxyethane;Ethylene glycol monomethyl ether acetate;Methyl Cellosolve(rg acetate;2-sulfanylethyl acetate |
| MF | C4H8O2S |
| Molecuulgewicht | 120.1701 |
| InChI | InChI=1/C4H8O2S/c1-4(5)6-2-3-7/h7H,2-3H2,1H3 |
| CAS-nummer | 110-49-6 |
| EINECS | 203-772-9 |
| Moleculaire Structuur |  |
| Dichtheid | 1.072g/cm3 |
| Smeltpunt | -65℃ |
| Kookpunt | 162.7°C at 760 mmHg |
| Brekingsindex | 1.452 |
| Vlampunt | 57.6°C |
| Dampdruk | 2.14mmHg at 25°C |
| Gevaarsymbolen |  T##Toxic:; |
| Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R60##May impair fertility.||R61##May cause harm to the unborn child.:; |
| Veiligheid Omschrijving | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 