ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1115-47-5 N-Acetyl-DL-methionine |
|
Naam product | N-Acetyl-DL-methionine |
Engelse naam | N-Acetyl-DL-methionine;Ac-DL-Met-OH;D.L Methionine N, acetyl;N-acetylmethionine;(2R)-2-(acetylamino)-4-(methylsulfanyl)butanoate |
MF | C7H12NO3S |
Molecuulgewicht | 190.2406 |
InChI | InChI=1/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/p-1/t6-/m1/s1 |
CAS-nummer | 1115-47-5 |
EINECS | 214-224-3 |
Moleculaire Structuur | ![]() |
Smeltpunt | 117-119℃ |
Kookpunt | 453.6°C at 760 mmHg |
Vlampunt | 228.1°C |
Dampdruk | 1.72E-09mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |