ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112-79-8 Elaidic acid |
|
| Naam product | Elaidic acid |
| Engelse naam | Elaidic acid;trans-9-Octadecenoic acid~trans-Oleic acid;trans-9-Octadecenic acid;(9E)-octadec-9-enoic acid |
| MF | C18H34O2 |
| Molecuulgewicht | 282.4614 |
| InChI | InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ |
| CAS-nummer | 112-79-8 |
| EINECS | 204-006-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.899g/cm3 |
| Smeltpunt | 43-45℃ |
| Kookpunt | 360°C at 760 mmHg |
| Brekingsindex | 1.466 |
| Vlampunt | 270.1°C |
| Dampdruk | 3.7E-06mmHg at 25°C |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |