ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
133662-13-2 3-amino-N'-[(E)-(2-chlorophenyl)methylidene]-2-methylpropanehydrazide |
|
| Naam product | 3-amino-N'-[(E)-(2-chlorophenyl)methylidene]-2-methylpropanehydrazide |
| Engelse naam | 3-amino-N'-[(E)-(2-chlorophenyl)methylidene]-2-methylpropanehydrazide; |
| MF | C11H14ClN3O |
| Molecuulgewicht | 239.7014 |
| InChI | InChI=1/C11H14ClN3O/c1-8(6-13)11(16)15-14-7-9-4-2-3-5-10(9)12/h2-5,7-8H,6,13H2,1H3,(H,15,16)/b14-7+ |
| CAS-nummer | 133662-13-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.241g/cm3 |
| Brekingsindex | 1.577 |
| MSDS | |