ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
16275-53-9 1-(2-methylpropyl)-3-phenylthiourea |
|
| Naam product | 1-(2-methylpropyl)-3-phenylthiourea |
| Engelse naam | 1-(2-methylpropyl)-3-phenylthiourea;1-Isobutyl-3-phenylthiourea;Thiourea, N-(2-methylpropyl)-N'-phenyl- |
| MF | C11H16N2S |
| Molecuulgewicht | 208.3231 |
| InChI | InChI=1/C11H16N2S/c1-9(2)8-12-11(14)13-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H2,12,13,14) |
| CAS-nummer | 16275-53-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.101g/cm3 |
| Kookpunt | 292.9°C at 760 mmHg |
| Brekingsindex | 1.606 |
| Vlampunt | 131°C |
| Dampdruk | 0.00178mmHg at 25°C |
| MSDS | |