ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
17135-52-3 1-(4-fluorophenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethanone |
|
| Naam product | 1-(4-fluorophenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethanone |
| Engelse naam | 1-(4-fluorophenyl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethanone;1-(4-Fluoro-phenyl)-2-[4-(2-methoxy-phenyl)-piperazin-1-yl]-ethanone |
| MF | C19H21FN2O2 |
| Molecuulgewicht | 328.3806 |
| InChI | InChI=1/C19H21FN2O2/c1-24-19-5-3-2-4-17(19)22-12-10-21(11-13-22)14-18(23)15-6-8-16(20)9-7-15/h2-9H,10-14H2,1H3 |
| CAS-nummer | 17135-52-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.181g/cm3 |
| Kookpunt | 483°C at 760 mmHg |
| Brekingsindex | 1.568 |
| Vlampunt | 245.9°C |
| Dampdruk | 1.74E-09mmHg at 25°C |
| MSDS | |