Chemindex > 17351-75-6
NL ▼
17351-75-6 Divinyloxy 1,4-cyclohexanedimethanol |
|
| Naam product | Divinyloxy 1,4-cyclohexanedimethanol |
| Engelse naam | Divinyloxy 1,4-cyclohexanedimethanol;1,4-Cyclohexanedimethanol divinyl ether,mixture of isomers;1,4-bis(prop-1-en-1-yloxy)cyclohexane;3,5-bis(1-methylethyl)-1H-pyrazole;1,4-Cyclohexan dimethanol divinyl ether |
| MF | C9H16N2 |
| Molecuulgewicht | 152.2367 |
| InChI | InChI=1/C9H16N2/c1-6(2)8-5-9(7(3)4)11-10-8/h5-7H,1-4H3,(H,10,11) |
| CAS-nummer | 17351-75-6 |
| Moleculaire Structuur |  |
| Dichtheid | 0.944g/cm3 |
| Smeltpunt | 6℃ |
| Kookpunt | 237.3°C at 760 mmHg |
| Brekingsindex | 1.496 |
| Vlampunt | 91.4°C |
| Dampdruk | 0.0696mmHg at 25°C |
| Gevaarsymbolen |  Xi##Irritant||N##Dangerous for the environment:; |
| Risico-codes | R43||R51/53:; |
| Veiligheid Omschrijving | S24||S37||S61:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 