ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2039-66-9 2-(2-aminoethyl)phenol |
|
| Naam product | 2-(2-aminoethyl)phenol |
| Engelse naam | 2-(2-aminoethyl)phenol; |
| MF | C8H11NO |
| Molecuulgewicht | 137.179 |
| InChI | InChI=1/C8H11NO/c9-6-5-7-3-1-2-4-8(7)10/h1-4,10H,5-6,9H2 |
| CAS-nummer | 2039-66-9 |
| EINECS | 218-016-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.103g/cm3 |
| Kookpunt | 258°C at 760 mmHg |
| Brekingsindex | 1.577 |
| Vlampunt | 109.9°C |
| Dampdruk | 0.00871mmHg at 25°C |
| MSDS | |