ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216019-28-2 3-Isopropylbenzeneboronic acid |
|
Naam product | 3-Isopropylbenzeneboronic acid |
Engelse naam | 3-Isopropylbenzeneboronic acid;3-Cumylboronic acid;3-Isopropylphenylboronic acid;(3-Isopropylphenyl)boronic acid;[3-(1-methylethyl)phenyl]boronic acid;3-isopropylphenylboronicacid;3-Isoprophenylboronic Acid |
MF | C9H13BO2 |
Molecuulgewicht | 164.0093 |
InChI | InChI=1/C9H13BO2/c1-7(2)8-4-3-5-9(6-8)10(11)12/h3-7,11-12H,1-2H3 |
CAS-nummer | 216019-28-2 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.04g/cm3 |
Kookpunt | 294.2°C at 760 mmHg |
Brekingsindex | 1.513 |
Vlampunt | 131.7°C |
Dampdruk | 0.000747mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |