ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2164-33-2 2-Chloromethyl-1,4-benzodioxane |
|
Naam product | 2-Chloromethyl-1,4-benzodioxane |
Engelse naam | 2-Chloromethyl-1,4-benzodioxane;2-(Chloromethyl)-2,3-dihydro-1,4-benzodioxine;2-(chloromethyl)-2,3-dihydrobenzo[b][1,4]dioxine; |
MF | C9H9ClO2 |
Molecuulgewicht | 184.6196 |
InChI | InChI=1/C9H9ClO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,5-6H2 |
CAS-nummer | 2164-33-2 |
EINECS | 218-502-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.224g/cm3 |
Kookpunt | 270.1°C at 760 mmHg |
Brekingsindex | 1.529 |
Vlampunt | 114.3°C |
Dampdruk | 0.0116mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R34##Causes burns.:; |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |