ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21764-08-9 3'-benzyloxy-4',5,6,7-tetramethoxyflavon |
|
Naam product | 3'-benzyloxy-4',5,6,7-tetramethoxyflavon |
Synoniemen | 2-[3-(benzyloxy)-4-methoxyfenyl]-5,6,7-trimethoxy-4H-chromen-4-on; |
Engelse naam | 3'-Benzyloxy-4',5,6,7-tetramethoxyflavone;2-[3-(benzyloxy)-4-methoxyphenyl]-5,6,7-trimethoxy-4H-chromen-4-one |
MF | C26H24O7 |
Molecuulgewicht | 448.4646 |
InChI | InChI=1/C26H24O7/c1-28-19-11-10-17(12-21(19)32-15-16-8-6-5-7-9-16)20-13-18(27)24-22(33-20)14-23(29-2)25(30-3)26(24)31-4/h5-14H,15H2,1-4H3 |
CAS-nummer | 21764-08-9 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.245g/cm3 |
Kookpunt | 628.9°C at 760 mmHg |
Brekingsindex | 1.593 |
Vlampunt | 270.5°C |
Dampdruk | 9.9E-16mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |