ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22053-74-3 3-Methylbenzo[b]thiophene-2-carboxaldehyde |
|
Naam product | 3-Methylbenzo[b]thiophene-2-carboxaldehyde |
Engelse naam | 3-Methylbenzo[b]thiophene-2-carboxaldehyde;Methylbenzobthiophenecarboxaldehyde;3-Methylthianaphthene-2-carboxaldehyde;3-methyl-1-benzothiophene-2-carbaldehyde |
MF | C10H8OS |
Molecuulgewicht | 176.2349 |
InChI | InChI=1/C10H8OS/c1-7-8-4-2-3-5-9(8)12-10(7)6-11/h2-6H,1H3 |
CAS-nummer | 22053-74-3 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.25g/cm3 |
Smeltpunt | 88-90℃ |
Kookpunt | 318.9°C at 760 mmHg |
Brekingsindex | 1.692 |
Vlampunt | 146.7°C |
Dampdruk | 0.00035mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |