ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22395-24-0 3',4',7-Trimethoxyflavone |
|
| Naam product | 3',4',7-Trimethoxyflavone |
| Engelse naam | 3',4',7-Trimethoxyflavone;7,3',4'-Trimethoxyflavone;2-(3,4-Dimethoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one;4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-7-methoxy-;2-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromen-4-one |
| MF | C18H16O5 |
| Molecuulgewicht | 312.3166 |
| InChI | InChI=1/C18H16O5/c1-20-12-5-6-13-14(19)10-16(23-17(13)9-12)11-4-7-15(21-2)18(8-11)22-3/h4-10H,1-3H3 |
| CAS-nummer | 22395-24-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.242g/cm3 |
| Kookpunt | 477.4°C at 760 mmHg |
| Brekingsindex | 1.585 |
| Vlampunt | 212°C |
| Dampdruk | 2.81E-09mmHg at 25°C |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |