ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22536-67-0 2,5-DICHLOROPYRIMIDINE |
|
| Naam product | 2,5-DICHLOROPYRIMIDINE |
| Engelse naam | 2,5-DICHLOROPYRIMIDINE;Pyrimidine, 2,5-dichloro- |
| MF | C4H2Cl2N2 |
| Molecuulgewicht | 148.9781 |
| InChI | InChI=1/C4H2Cl2N2/c5-3-1-7-4(6)8-2-3/h1-2H |
| CAS-nummer | 22536-67-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.493g/cm3 |
| Smeltpunt | 57.0-57.5℃ |
| Kookpunt | 265.3°C at 760 mmHg |
| Brekingsindex | 1.559 |
| Vlampunt | 139.8°C |
| Dampdruk | 0.0152mmHg at 25°C |
| MSDS | |