ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2295-38-7 2-(pyridine-4-yl)-1,3-benzothiazol |
|
| Naam product | 2-(pyridine-4-yl)-1,3-benzothiazol |
| Synoniemen | benzothiazol, 2-(4-pyridinyl)-; |
| Engelse naam | 2-(pyridin-4-yl)-1,3-benzothiazole;benzothiazole, 2-(4-pyridinyl)- |
| MF | C12H8N2S |
| Molecuulgewicht | 212.2703 |
| InChI | InChI=1/C12H8N2S/c1-2-4-11-10(3-1)14-12(15-11)9-5-7-13-8-6-9/h1-8H |
| CAS-nummer | 2295-38-7;51784-73-7 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.288g/cm3 |
| Kookpunt | 393°C at 760 mmHg |
| Brekingsindex | 1.693 |
| Vlampunt | 188.4°C |
| Dampdruk | 5E-06mmHg at 25°C |
| MSDS | |