ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25717-12-8 N-(2-methylfenyl)-1,3-benzothiazol-2-amine |
|
| Naam product | N-(2-methylfenyl)-1,3-benzothiazol-2-amine |
| Synoniemen | 2-benzothiazolamine, N-(2-methylfenyl)-; Benzothiazol-2-yl-o-tolyl-amine; |
| Engelse naam | N-(2-methylphenyl)-1,3-benzothiazol-2-amine;2-benzothiazolamine, N-(2-methylphenyl)-;Benzothiazol-2-yl-o-tolyl-amine |
| MF | C14H12N2S |
| Molecuulgewicht | 240.3235 |
| InChI | InChI=1/C14H12N2S/c1-10-6-2-3-7-11(10)15-14-16-12-8-4-5-9-13(12)17-14/h2-9H,1H3,(H,15,16) |
| CAS-nummer | 25717-12-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.274g/cm3 |
| Kookpunt | 381.1°C at 760 mmHg |
| Brekingsindex | 1.723 |
| Vlampunt | 184.3°C |
| Dampdruk | 5.21E-06mmHg at 25°C |
| MSDS | |