ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25952-74-3 3,5-dibroom-4-hydroxybenzaldehyde-oxime |
|
Naam product | 3,5-dibroom-4-hydroxybenzaldehyde-oxime |
Synoniemen | 2,6-dibroom-4-[(E)-(hydroxyimino)methyl]fenol; |
Engelse naam | 3,5-dibromo-4-hydroxybenzaldehyde oxime;2,6-dibromo-4-[(E)-(hydroxyimino)methyl]phenol |
MF | C7H5Br2NO2 |
Molecuulgewicht | 294.9281 |
InChI | InChI=1/C7H5Br2NO2/c8-5-1-4(3-10-12)2-6(9)7(5)11/h1-3,11-12H/b10-3+ |
CAS-nummer | 25952-74-3 |
Moleculaire Structuur | ![]() |
Dichtheid | 2.091g/cm3 |
Smeltpunt | 198℃ |
Kookpunt | 311.907°C at 760 mmHg |
Brekingsindex | 1.661 |
Vlampunt | 142.436°C |
Dampdruk | 0mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |