ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26315-61-7 (1R)-(-)-Menthyl glyoxylate hydrate |
|
Naam product | (1R)-(-)-Menthyl glyoxylate hydrate |
Engelse naam | (1R)-(-)-Menthyl glyoxylate hydrate;Glyoxylic acid (1R)-menthyl ester hydrate;(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl oxoacetate |
MF | C12H20O3 |
Molecuulgewicht | 212.2854 |
InChI | InChI=1/C12H20O3/c1-8(2)10-5-4-9(3)6-11(10)15-12(14)7-13/h7-11H,4-6H2,1-3H3/t9-,10+,11-/m1/s1 |
CAS-nummer | 26315-61-7 |
Moleculaire Structuur | ![]() |
Dichtheid | 1g/cm3 |
Kookpunt | 282°C at 760 mmHg |
Brekingsindex | 1.458 |
Vlampunt | 116.5°C |
Dampdruk | 0.00344mmHg at 25°C |
Risico-codes | R51/53##Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
Veiligheid Omschrijving | S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
MSDS |