ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27563-26-4 4-[3-(naphthalen-1-yl)butyl]morpholine |
|
| Naam product | 4-[3-(naphthalen-1-yl)butyl]morpholine |
| Engelse naam | 4-[3-(naphthalen-1-yl)butyl]morpholine; |
| MF | C18H23NO |
| Molecuulgewicht | 269.3813 |
| InChI | InChI=1/C18H23NO/c1-15(9-10-19-11-13-20-14-12-19)17-8-4-6-16-5-2-3-7-18(16)17/h2-8,15H,9-14H2,1H3 |
| CAS-nummer | 27563-26-4 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.057g/cm3 |
| Kookpunt | 411.2°C at 760 mmHg |
| Brekingsindex | 1.578 |
| Vlampunt | 120.8°C |
| Dampdruk | 5.68E-07mmHg at 25°C |
| MSDS | |